5-Nitroso-2,4,6-triaminopyrimidine
- Product Name5-Nitroso-2,4,6-triaminopyrimidine
- CAS1006-23-1
- MFC4H6N6O
- MW154.13
- EINECS213-742-7
- MOL File1006-23-1.mol
Chemical Properties
| Melting point | 300 °C |
| Boiling point | 277.47°C (rough estimate) |
| Density | 1.4788 (rough estimate) |
| refractive index | 1.7290 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMF (Slightly, Heated), DMSO (Slightly, Heated) |
| pka | 4.07±0.10(Predicted) |
| color | Light Pink to Pink |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C4H6N6O/c5-2-1(10-11)3(6)9-4(7)8-2/h(H6,5,6,7,8,9) |
| InChIKey | XLQQJSWJHHKLOK-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(N)=C(N=O)C(N)=N1 |
| CAS DataBase Reference | 1006-23-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,6-Pyrimidinetriamine, 5-nitroso- (1006-23-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
