| Melting point |
300 °C |
| Boiling point |
277.47°C (rough estimate) |
| Density |
1.4788 (rough estimate) |
| refractive index |
1.7290 (estimate) |
| storage temp. |
-20°C Freezer |
| solubility |
DMF (Slightly, Heated), DMSO (Slightly, Heated) |
| pka |
4.07±0.10(Predicted) |
| color |
Light Pink to Pink |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C4H6N6O/c5-2-1(10-11)3(6)9-4(7)8-2/h(H6,5,6,7,8,9) |
| InChIKey |
XLQQJSWJHHKLOK-UHFFFAOYSA-N |
| SMILES |
C1(N)=NC(N)=C(N=O)C(N)=N1 |
| CAS DataBase Reference |
1006-23-1(CAS DataBase Reference) |
| EPA Substance Registry System |
2,4,6-Pyrimidinetriamine, 5-nitroso- (1006-23-1) |
