5-Chloro-2-nitrotoluene
- Product Name5-Chloro-2-nitrotoluene
- CAS5367-28-2
- MFC7H6ClNO2
- MW171.58
- EINECS226-355-3
- MOL File5367-28-2.mol
Chemical Properties
| Melting point | 27-30 °C (lit.) |
| Boiling point | 124-126 °C (16 mmHg) |
| Density | 1.32 |
| refractive index | 1.57-1.572 |
| Flash point | 202 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to lump |
| color | White to Light yellow |
| Water Solubility | insoluble |
| InChI | 1S/C7H6ClNO2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | NSMZCUAVEOTJDS-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1[N+]([O-])=O |
| CAS DataBase Reference | 5367-28-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-2-nitrotoluene(5367-28-2) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-36/37/38-20/21/22-52/53 |
| Safety Statements | 26-36-36/37/39-61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XS9134000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |