3-Methoxy-2-nitropyridine
- Product Name3-Methoxy-2-nitropyridine
- CAS20265-37-6
- MFC6H6N2O3
- MW154.12
- EINECS606-480-3
- MOL File20265-37-6.mol
Chemical Properties
| Melting point | 73-76 °C (lit.) |
| Boiling point | 311.8±22.0 °C(Predicted) |
| Density | 1.300±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -6.34±0.10(Predicted) |
| color | White to Yellow to Green |
| InChI | InChI=1S/C6H6N2O3/c1-11-5-3-2-4-7-6(5)8(9)10/h2-4H,1H3 |
| InChIKey | QRCUQLANPHYVEH-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=CC=C1OC |
| CAS DataBase Reference | 20265-37-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
