5-Methoxypyrazine-2-carboxylic acid
- Product Name5-Methoxypyrazine-2-carboxylic acid
- CAS40155-42-8
- MFC6H6N2O3
- MW154.12
- EINECS
- MOL File40155-42-8.mol
Chemical Properties
| Melting point | 197.5-199.5℃ |
| Boiling point | 296.8±35.0 °C(Predicted) |
| Density | 1.371±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.18±0.10(Predicted) |
| form | Solid |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C6H6N2O3/c1-11-5-3-7-4(2-8-5)6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | YVGVOPNUEFTVQO-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=C(OC)N=C1 |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |