| Boiling point |
221 °C(lit.) |
| Density |
1.290 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.523(lit.) |
| Flash point |
>230 °F |
| storage temp. |
2-8°C |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| optical activity |
[α]23/D 228°, neat |
| BRN |
5404068 |
| InChI |
1S/C9H7ClO3/c10-9(12)8(13-6-11)7-4-2-1-3-5-7/h1-6,8H/t8-/m1/s1 |
| InChIKey |
YASBRFHEBZXBJW-SSDOTTSWSA-N |
| SMILES |
ClC(=O)[C@H](OC=O)c1ccccc1 |
| CAS DataBase Reference |
29169-64-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzeneacetyl chloride, .alpha.-(formyloxy)-, (.alpha.R)- (29169-64-0) |
