2-Nitro-3-pyridinamine
- Product Name2-Nitro-3-pyridinamine
- CAS13269-19-7
- MFC5H5N3O2
- MW139.11
- EINECS236-260-9
- MOL File13269-19-7.mol
Chemical Properties
| Melting point | 194 °C |
| Boiling point | 382.3±22.0 °C(Predicted) |
| Density | 1.437 |
| Flash point | 185℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | -1.66±0.22(Predicted) |
| color | White to Yellow to Orange |
| BRN | 124467 |
| InChI | InChI=1S/C5H5N3O2/c6-4-2-1-3-7-5(4)8(9)10/h1-3H,6H2 |
| InChIKey | GZBKVUGZEAJYHH-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=CC=C1N |
| CAS DataBase Reference | 13269-19-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 23/24/25-36/37/38-20/21/22-22 |
| Safety Statements | 28-36/37/39-45-36-26-24/25 |
| PackingGroup | II |
| HS Code | 29339900 |
