Ethyl 4-chloro-2-methylthio-5-pyrimidinecarboxylate
- Product NameEthyl 4-chloro-2-methylthio-5-pyrimidinecarboxylate
- CAS5909-24-0
- MFC8H9ClN2O2S
- MW232.69
- EINECS227-619-0
- MOL File5909-24-0.mol
Chemical Properties
| Melting point | 60-63 °C (lit.) |
| Boiling point | 132°C/0.4mmHg(lit.) |
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| pka | -2.19±0.29(Predicted) |
| color | White to light yellow to beige |
| InChI | InChI=1S/C8H9ClN2O2S/c1-3-13-7(12)5-4-10-8(14-2)11-6(5)9/h4H,3H2,1-2H3 |
| InChIKey | SNNHLSHDDGJVDM-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=C(C(OCC)=O)C(Cl)=N1 |
| CAS DataBase Reference | 5909-24-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
