Kryptofix 222
- Product NameKryptofix 222
- CAS23978-09-8
- MFC18H36N2O6
- MW376.49
- EINECS245-962-4
- MOL File23978-09-8.mol
Chemical Properties
| Melting point | 68-71 °C(lit.) |
| Boiling point | 505.03°C (rough estimate) |
| Density | 1.1888 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 7.21±0.20(Predicted) |
| color | White to Off-White |
| Water Solubility | soluble |
| BRN | 620282 |
| InChI | InChI=1S/C18H36N2O6/c1-7-21-13-14-24-10-4-20-5-11-25-17-15-22-8-2-19(1)3-9-23-16-18-26-12-6-20/h1-18H2 |
| InChIKey | AUFVJZSDSXXFOI-UHFFFAOYSA-N |
| SMILES | N12CCOCCOCCN(CCOCCOCC1)CCOCCOCC2 |
| CAS DataBase Reference | 23978-09-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane(23978-09-8) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| RTECS | MP4750000 |
| HS Code | 2934 99 90 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 |
| Toxicity | LD50 orally in Rabbit: > 300 - 2000 mg/kg |
