| Melting point |
104-106°C |
| alpha |
-12.5 º (c=1%, DMF) |
| Boiling point |
599.3±50.0 °C(Predicted) |
| Density |
1.362±0.06 g/cm3(Predicted) |
| refractive index |
-12.5 ° (C=1, DMF) |
| storage temp. |
2-8°C |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
3.51±0.10(Predicted) |
| color |
White to Light yellow |
| optical activity |
[α]20/D 12.5±1°, c = 1% in DMF |
| BRN |
4715791 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C18H17NO5/c20-9-16(17(21)22)19-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20H,9-10H2,(H,19,23)(H,21,22)/t16-/m0/s1 |
| InChIKey |
JZTKZVJMSCONAK-INIZCTEOSA-N |
| SMILES |
C(O)(=O)[C@H](CO)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference |
73724-45-5(CAS DataBase Reference) |