4-BROMOBENZOPHENONE
- Product Name4-BROMOBENZOPHENONE
- CAS90-90-4
- MFC13H9BrO
- MW261.11
- EINECS202-024-9
- MOL File90-90-4.mol
Chemical Properties
| Melting point | 79-84 °C(lit.) |
| Boiling point | 350 °C(lit.) |
| Density | 1.4245 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| Flash point | 350°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to light beige |
| Water Solubility | Insoluble in water but slightly soluble in other solvents such as ethanol, ether and benzene. |
| BRN | 1910182 |
| InChI | InChI=1S/C13H9BrO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
| InChIKey | KEOLYBMGRQYQTN-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 90-90-4(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Bromobenzophenone (90-90-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| RTECS | DJ0350000 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
