| Melting point |
64-67 °C (lit.) |
| Boiling point |
313.4±17.0 °C(Predicted) |
| Density |
1.187±0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 20℃ |
| refractive index |
42.5 ° (C=1, CHCl3) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
9320 in mg/100g standard fat at 20 ℃ |
| form |
powder to crystal |
| pka |
10.07±0.15(Predicted) |
| color |
White to Orange to Green |
| optical activity |
[α]22/D +43°, c = 1 in chloroform |
| Water Solubility |
13.46g/L at 20℃ |
| InChI |
1S/C10H12O4/c1-7(10(12)13-2)14-9-5-3-8(11)4-6-9/h3-7,11H,1-2H3/t7-/m1/s1 |
| InChIKey |
UUYSCNGPNOYZMC-SSDOTTSWSA-N |
| SMILES |
COC(=O)[C@@H](C)Oc1ccc(O)cc1 |
| LogP |
1.29 at 22℃ |
| CAS DataBase Reference |
96562-58-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- (96562-58-2) |
