5-Bromo-8-nitroisoquinoline
- Product Name5-Bromo-8-nitroisoquinoline
- CAS63927-23-1
- MFC9H5BrN2O2
- MW253.05
- EINECS804-292-8
- MOL File63927-23-1.mol
Chemical Properties
| Melting point | 136-140 °C |
| Boiling point | 386.9±27.0 °C(Predicted) |
| Density | 1.747±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2+-.0.36(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C9H5BrN2O2/c10-8-1-2-9(12(13)14)7-5-11-4-3-6(7)8/h1-5H |
| InChIKey | ULGOLOXWHJEZNZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Br)c2ccncc12 |
| CAS DataBase Reference | 63927-23-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-37/38-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 |