Dimethyl pyridine-2,5-dicarboxylate
- Product NameDimethyl pyridine-2,5-dicarboxylate
- CAS881-86-7
- MFC9H9NO4
- MW195.17
- EINECS629-154-2
- MOL File881-86-7.mol
Chemical Properties
| Melting point | 213-217 °C(lit.) |
| Boiling point | 302.9±22.0 °C(Predicted) |
| Density | 1.231±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Dichloromethane, Ethyl Acetate |
| pka | -0.35±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in Dichloromethane and Ethyl Acetate. Insoluble in water. |
| BRN | 172251 |
| InChI | InChI=1S/C9H9NO4/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2/h3-5H,1-2H3 |
| InChIKey | TUGSJNQAIMFEDY-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=C(C(OC)=O)C=C1 |
| CAS DataBase Reference | 881-86-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |