Chemical Properties
| Melting point | 202-205 °C(lit.) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Acetonitrile (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) |
| pka | 8.67±0.46(Predicted) |
| form | Off-white to yellow solid. |
| color | Pale Yellow to Green |
| biological source | synthetic |
| Stability | Unstable in methanol |
| InChI | InChI=1S/C11H18ClN7O/c1-4-19(5(2)3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20) |
| InChIKey | QDERNBXNXJCIQK-UHFFFAOYSA-N |
| SMILES | C1(C(NC(N)=N)=O)=NC(Cl)=C(N(CC)C(C)C)N=C1N |
| CAS DataBase Reference | 1154-25-2 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
