| Boiling point |
100-102 °C (22 mmHg) |
| Density |
1.096 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.5059(lit.) |
| Flash point |
170 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
clear liquid |
| Specific Gravity |
1.096 |
| color |
Colorless to Light orange to Yellow |
| BRN |
1210310 |
| InChI |
InChI=1S/C9H9FO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey |
QIJNVLLXIIPXQT-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=C(F)C=C1)(=O)CC |
| CAS DataBase Reference |
456-03-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
1-Propanone, 1-(4-fluorophenyl)-(456-03-1) |
