4'-Fluoropropiophenone
- Product Name4'-Fluoropropiophenone
- CAS456-03-1
- MFC9H9FO
- MW152.17
- EINECS207-255-9
- MOL File456-03-1.mol
Chemical Properties
| Boiling point | 100-102 °C (22 mmHg) |
| Density | 1.096 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 170 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.096 |
| color | Colorless to Light orange to Yellow |
| BRN | 1210310 |
| InChI | InChI=1S/C9H9FO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | QIJNVLLXIIPXQT-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(F)C=C1)(=O)CC |
| CAS DataBase Reference | 456-03-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Propanone, 1-(4-fluorophenyl)-(456-03-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-39-37/39 |
| RIDADR | 2735 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |