N-Methyl-o-toluidine
- Product NameN-Methyl-o-toluidine
- CAS611-21-2
- MFC8H11N
- MW121.18
- EINECS210-260-9
- MOL File611-21-2.mol
Chemical Properties
| Melting point | -10.08°C (estimate) |
| Boiling point | 207 °C |
| Density | 0.97 |
| refractive index | 1.562-1.565 |
| Flash point | 79.4 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Practically insoluble in water |
| form | clear liquid |
| pka | 4.72±0.10(Predicted) |
| color | White to Yellow to Green |
| InChI | InChI=1S/C8H11N/c1-7-5-3-4-6-8(7)9-2/h3-6,9H,1-2H3 |
| InChIKey | GUAWMXYQZKVRCW-UHFFFAOYSA-N |
| SMILES | C1(NC)=CC=CC=C1C |
| CAS DataBase Reference | 611-21-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, N,2-dimethyl- (611-21-2) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 52/53-33-23/24/25 |
| Safety Statements | 61-45-36/37-28A-28 |
| RIDADR | 1711 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 2921490090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 STOT RE 2 |