Benzyltrimethylammonium tetrachloroiodate
- Product NameBenzyltrimethylammonium tetrachloroiodate
- CAS121309-88-4
- MFC10H16Cl4IN
- MW418.96
- EINECS
- MOL File121309-88-4.mol
Chemical Properties
| Melting point | 106-125 °C |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | sol MeCN, MeNO3, DMSO, DMF; slightly sol MeOH, EtOH, AcOH, AcOEt, CHCl3, CH2Cl2; insol C6H14, CCl4, C6H6, H2O. |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 4619219 |
| InChI | 1S/C10H16N.Cl4I/c1-11(2,3)9-10-7-5-4-6-8-10;1-5(2,3)4/h4-8H,9H2,1-3H3;/q+1;-1 |
| InChIKey | IBXYFQYYVRYALP-UHFFFAOYSA-N |
| SMILES | Cl[I-](Cl)(Cl)Cl.C[N+](C)(C)Cc1ccccc1 |
| CAS DataBase Reference | 121309-88-4 |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| F | 4.4-8 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |