Spirodiclofen
- Product NameSpirodiclofen
- CAS148477-71-8
- MFC21H24Cl2O4
- MW411.32
- EINECS604-636-5
- MOL File148477-71-8.mol
Chemical Properties
| Melting point | 101-108° |
| Boiling point | 550.2±50.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-25℃ |
| Flash point | 4 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO, Methanol (Sparingly) |
| form | Solid |
| color | White to Off-White |
| Major Application | agriculture environmental |
| InChI | 1S/C21H24Cl2O4/c1-4-20(2,3)19(25)26-17-16(14-9-8-13(22)12-15(14)23)18(24)27-21(17)10-6-5-7-11-21/h8-9,12H,4-7,10-11H2,1-3H3 |
| InChIKey | DTDSAWVUFPGDMX-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C(=O)OC1=C(C(=O)OC12CCCCC2)c3ccc(Cl)cc3Cl |
| LogP | 5.83 at 20℃ and pH4 |
| EPA Substance Registry System | Spirodiclofen (148477-71-8) |
Safety Information
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 43-67-65-63-48/20-38-11 |
| Safety Statements | 36/37-62 |
| RIDADR | UN1294 3/PG 2 |
| WGK Germany | 2 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 1 Carc. 1B Repr. 2 Skin Sens. 1B STOT RE 2 |
| Hazardous Substances Data | 148477-71-8(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >2500 orally; >2000 dermally (24 hr); LC50 (4 hr) in rats (mg/m3): >5000 by inhalation; LC50 (96 hr) in fish: >68 mg/l (Wachendorff) |
