(S)-Styrene oxide
- Product Name(S)-Styrene oxide
- CAS20780-54-5
- MFC8H8O
- MW120.15
- EINECS
- MOL File20780-54-5.mol
Chemical Properties
| alpha | -33 º (neat) |
| Boiling point | 192-194 °C(lit.) |
| Density | 1.051 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 175 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| optical activity | [α]20/D 33°, neat |
| BRN | 3587977 |
| InChI | InChI=1S/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5,8H,6H2/t8-/m1/s1 |
| InChIKey | AWMVMTVKBNGEAK-MRVPVSSYSA-N |
| SMILES | O1C[C@@H]1C1=CC=CC=C1 |
| CAS DataBase Reference | 20780-54-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-20/21-36/38 |
| Safety Statements | 53-26-36/37-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CZ9625030 |
| F | 10 |
| HazardClass | 6.1 |
| HS Code | 2910900090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Aquatic Chronic 2 Carc. 1B Eye Irrit. 2 Skin Irrit. 2 |
