2,3-Dibromopyridine
- Product Name2,3-Dibromopyridine
- CAS13534-89-9
- MFC5H3Br2N
- MW236.89
- EINECS626-632-2
- MOL File13534-89-9.mol
Chemical Properties
| Melting point | 56-60 °C |
| Boiling point | 249-250°C |
| Density | 2.0383 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Flash point | 249-250°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -1.57±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| BRN | 109828 |
| InChI | InChI=1S/C5H3Br2N/c6-4-2-1-3-8-5(4)7/h1-3H |
| InChIKey | SLMHHOVQRSSRCV-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC=C1Br |
| CAS DataBase Reference | 13534-89-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
