Metamitron
- Product NameMetamitron
- CAS41394-05-2
- MFC10H10N4O
- MW202.21
- EINECS255-349-3
- MOL File41394-05-2.mol
Chemical Properties
| Melting point | 165-170 °C |
| Boiling point | 340.33°C (rough estimate) |
| Density | 1.2165 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| Flash point | 11 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.54±0.20(Predicted) |
| color | White to Light yellow |
| Water Solubility | 1.8g/L(20 ºC) |
| λmax | 312nm(CH3CN)(lit.) |
| Merck | 14,5924 |
| BRN | 613129 |
| Henry's Law Constant | 1.0×106 mol/(m3Pa) at 25℃, Barcelo and Hennion (1997) |
| InChI | 1S/C10H10N4O/c1-7-12-13-9(10(15)14(7)11)8-5-3-2-4-6-8/h2-6H,11H2,1H3 |
| InChIKey | VHCNQEUWZYOAEV-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(c2ccccc2)C(=O)N1N |
Safety Information
| Hazard Codes | Xn,N,T,F |
| Risk Statements | 22-50-39/23/24/25-23/24/25-11 |
| Safety Statements | 61-45-36/37 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | XZ3015000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29336990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity | LD50 orally in male, female rats, male, female mice: 3343, 1832, 1450, 1463 mg/kg; dermally in rats: >500 mg/kg; LC50 (4 hr) in rats, mice, hamsters (mg/m3): >331, >206, >206 by inhalation (Lembrich) |
