| Melting point |
176 °C |
| Boiling point |
414.7±40.0 °C(Predicted) |
| Density |
1+-.0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
3.95g/L in organic solvents at 20 ℃ |
| form |
powder to crystal |
| pka |
10.21±0.10(Predicted) |
| color |
White to Almost white |
| Water Solubility |
100mg/L at 25℃ |
| InChI |
InChI=1S/C17H20O2/c1-10-5-14(6-11(2)16(10)18)9-15-7-12(3)17(19)13(4)8-15/h5-8,18-19H,9H2,1-4H3 |
| InChIKey |
AZZWZMUXHALBCQ-UHFFFAOYSA-N |
| SMILES |
C(C1=CC(C)=C(O)C(C)=C1)C1=CC(C)=C(O)C(C)=C1 |
| LogP |
3.75 at 25℃ |
| CAS DataBase Reference |
5384-21-4 |
| EPA Substance Registry System |
Phenol, 4,4'-methylenebis[2,6-dimethyl- (5384-21-4) |
