Sodium 4-hydroxybenzoate
- Product NameSodium 4-hydroxybenzoate
- CAS114-63-6
- MFC7H5NaO3
- MW160.1
- EINECS204-051-1
- MOL File114-63-6.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to light beige |
| Water Solubility | Soluble in water. |
| BRN | 4163553 |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| InChI | InChI=1S/C7H6O3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| InChIKey | ZLVSYODPTJZFMK-UHFFFAOYSA-M |
| SMILES | C1(C=CC(O)=CC=1)C([O-])=O.[Na+] |
| CAS DataBase Reference | 114-63-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-hydroxy-, monosodium salt (114-63-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | DH2900000 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LD50,intravenous,1200mg/kg (1200mg/kg),Journal of the American Pharmaceutical Association, Scientific Edition. Vol. 45, Pg. 260, 1956. |
