2-FLUOROTHIOPHENOL
- Product Name2-FLUOROTHIOPHENOL
- CAS2557-78-0
- MFC6H5FS
- MW128.17
- EINECS202-710-8
- MOL File2557-78-0.mol
Chemical Properties
| Boiling point | 61-62 °C/35 mmHg (lit.) |
| Density | 1.2 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 118 °F |
| storage temp. | 2-8°C |
| pka | 6.00±0.43(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.20 |
| Sensitive | Stench |
| BRN | 2039768 |
| CAS DataBase Reference | 2557-78-0(CAS DataBase Reference) |
| NIST Chemistry Reference | O-fluorothiophenol(2557-78-0) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36-36/37/39-27 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Stench |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29309090 |
