N,N-Dimethylformamide dineopentyl acetal
- Product NameN,N-Dimethylformamide dineopentyl acetal
- CAS4909-78-8
- MFC13H29NO2
- MW231.37
- EINECS225-536-4
- MOL File4909-78-8.mol
Chemical Properties
| Melting point | 253.5℃ |
| Boiling point | 85-87 °C/10 mmHg (lit.) |
| Density | 0.829 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 125 °F |
| storage temp. | Store at 0-5°C |
| pka | 5.24±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Hydrolyzes with water. |
| Sensitive | Moisture Sensitive |
| BRN | 741992 |
| InChI | InChI=1S/C13H29NO2/c1-12(2,3)9-15-11(14(7)8)16-10-13(4,5)6/h11H,9-10H2,1-8H3 |
| InChIKey | KEXFRBIOHPDZQM-UHFFFAOYSA-N |
| SMILES | C(OCC(C)(C)C)(OCC(C)(C)C)N(C)C |
| CAS DataBase Reference | 4909-78-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| F | 9-21 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29110000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |