4,4'-(Hexafluoroisopropylidene)diphthalic anhydride
- Product Name4,4'-(Hexafluoroisopropylidene)diphthalic anhydride
- CAS1107-00-2
- MFC19H6F6O6
- MW444.24
- EINECS214-170-0
- MOL File1107-00-2.mol
Chemical Properties
| Melting point | 244-247 °C(lit.) |
| Boiling point | 494.5±45.0 °C(Predicted) |
| Density | 1.697±0.06 g/cm3(Predicted) |
| vapor pressure | 7.7Pa at 20℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Miscible with water. |
| Sensitive | Moisture Sensitive |
| BRN | 7057916 |
| InChI | InChI=1S/C19H6F6O6/c20-18(21,22)17(19(23,24)25,7-1-3-9-11(5-7)15(28)30-13(9)26)8-2-4-10-12(6-8)16(29)31-14(10)27/h1-6H |
| InChIKey | QHHKLPCQTTWFSS-UHFFFAOYSA-N |
| SMILES | C(C1C=CC2C(=O)OC(=O)C=2C=1)(C1C=CC2C(=O)OC(=O)C=2C=1)(C(F)(F)F)C(F)(F)F |
| LogP | 5.59 at 25℃ |
| CAS DataBase Reference | 1107-00-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Isobenzofurandione, 5,5'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (1107-00-2) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 1 |
| F | 21 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29173990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |