2-Fluoro-6-nitrotoluene
- Product Name2-Fluoro-6-nitrotoluene
- CAS769-10-8
- MFC7H6FNO2
- MW155.13
- EINECS212-203-3
- MOL File769-10-8.mol
Chemical Properties
| Melting point | 6.5-7 °C (lit.) |
| Boiling point | 97 °C/11 mmHg (lit.) |
| Density | 1.27 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 192 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Amber to Dark green |
| Specific Gravity | 1.270 |
| BRN | 2361978 |
| InChI | InChI=1S/C7H6FNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | GXPIVRKDWZKIKZ-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 769-10-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-28A-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
