Chemical Properties
| Boiling point | 593.1±25.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMF: 14 mg/ml; DMF:PBS(pH7.2) (1:2): 0.3 mg/ml; DMSO: 10 mg/ml; Ethanol: 1 mg/ml |
| form | A neat solid |
| pka | 2.21±0.17(Predicted) |
| Major Application | forensics and toxicology forensics and toxicology |
| InChI | 1S/C10H10N2O2/c1-14-10(13)8-5-7(11)4-6-2-3-12-9(6)8/h2-5,12H,11H2,1H3 |
| InChIKey | SBBYXUZCJIENKS-UHFFFAOYSA-N |
| SMILES | [nH]1c2c(cc1)cc(cc2C(=O)OC)N |
Safety Information
| WGK Germany | WGK 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
