1H-Pyrazole, 1-(1-Methylethyl)-4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-
- Product Name1H-Pyrazole, 1-(1-Methylethyl)-4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-
- CAS879487-10-2
- MFC12H21BN2O2
- MW236.12
- EINECS
- MOL File879487-10-2.mol
Chemical Properties
| Melting point | 36-44°C |
| Boiling point | 327.3±15.0 °C(Predicted) |
| Density | 1.03±0.1 g/cm3(Predicted) |
| Flash point | >110℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.13±0.10(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C12H21BN2O2/c1-9(2)15-8-10(7-14-15)13-16-11(3,4)12(5,6)17-13/h7-9H,1-6H3 |
| InChIKey | OGYYMVGDKVJYSU-UHFFFAOYSA-N |
| SMILES | CC(C)n1cc(cn1)B2OC(C)(C)C(C)(C)O2 |
| CAS DataBase Reference | 879487-10-2 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |