4'-Chloro-2-phenylacetophenone
- Product Name4'-Chloro-2-phenylacetophenone
- CAS1889-71-0
- MFC14H11ClO
- MW230.69
- EINECS
- MOL File1889-71-0.mol
Chemical Properties
| Melting point | 103-107 °C(lit.) |
| Boiling point | 187°C/8mmHg(lit.) |
| Density | 1.191±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 976443 |
| InChI | InChI=1S/C14H11ClO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | DXVALSKCLLBZEB-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C=C1)CC1=CC=CC=C1 |
| CAS DataBase Reference | 1889-71-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 41-43-51/53 |
| Safety Statements | 26-39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Sens. 1 |
