5-Aminobenzimidazole
- Product Name5-Aminobenzimidazole
- CAS934-22-5
- MFC7H7N3
- MW133.15
- EINECS213-279-0
- MOL File934-22-5.mol
Chemical Properties
| Melting point | 163-168 °C |
| Boiling point | 222°C/3.5mmHg(lit.) |
| Density | 1.367 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol[slightly sol. in] |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 14.47±0.30(Predicted) |
| color | Light yellow to Brown |
| λmax | 300nm(EtOH)(lit.) |
| InChI | InChI=1S/C7H7N3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H,8H2,(H,9,10) |
| InChIKey | WFRXSXUDWCVSPI-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(N)=CC=C2N=1 |
| CAS DataBase Reference | 934-22-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | DD5785000 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
