2,2'-((4-((2-Hydroxyethyl)amino)-3-nitrophenyl)imino)bisethanol
- Product Name2,2'-((4-((2-Hydroxyethyl)amino)-3-nitrophenyl)imino)bisethanol
- CAS33229-34-4
- MFC12H19N3O5
- MW285.3
- EINECS251-410-3
- MOL File33229-34-4.mol
Chemical Properties
| Melting point | 108-111 °C (lit.) |
| Boiling point | 427.73°C (rough estimate) |
| Density | 1.2263 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5600 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: soluble(lit.) |
| pka | 14.19±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| Water Solubility | 4.57g/L at 25℃ |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 2,2'-((4-((2-Hydroxyethyl)amino)-3-nitrophenyl)imino)bisethanol (33229-34-4) |
| InChI | 1S/C12H19N3O5/c16-6-3-13-11-2-1-10(9-12(11)15(19)20)14(4-7-17)5-8-18/h1-2,9,13,16-18H,3-8H2 |
| InChIKey | MIWUTEVJIISHCP-UHFFFAOYSA-N |
| SMILES | OCCNc1ccc(cc1[N+]([O-])=O)N(CCO)CCO |
| LogP | 0.01 at 20℃ |
| CAS DataBase Reference | 33229-34-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | KL2880000 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 33229-34-4(Hazardous Substances Data) |
