4,4'-Bis(N-carbazolyl)-1,1'-biphenyl
- Product Name4,4'-Bis(N-carbazolyl)-1,1'-biphenyl
- CAS58328-31-7
- MFC36H24N2
- MW484.59
- EINECS627-757-5
- MOL File58328-31-7.mol
Chemical Properties
| Melting point | 281-285 °C |
| Boiling point | 700.8±60.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slightly sol. in Tetrahydrofuran |
| form | powder to crystal |
| color | White to Almost white |
| biological source | mouse |
| λmax | 319nm(CH2Cl2)(lit.) |
| InChI | InChI=1S/C36H24N2/c1-5-13-33-29(9-1)30-10-2-6-14-34(30)37(33)27-21-17-25(18-22-27)26-19-23-28(24-20-26)38-35-15-7-3-11-31(35)32-12-4-8-16-36(32)38/h1-24H |
| InChIKey | VFUDMQLBKNMONU-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(N3C4=C(C=CC=C4)C4=C3C=CC=C4)C=C2)=CC=C(N2C3=C(C=CC=C3)C3=C2C=CC=C3)C=C1 |
| CAS DataBase Reference | 58328-31-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |