6-(Methylamino)purine
- Product Name6-(Methylamino)purine
- CAS443-72-1
- MFC6H7N5
- MW149.15
- EINECS207-137-7
- MOL File443-72-1.mol
Chemical Properties
| Melting point | ≥300 °C |
| Boiling point | 256.3±50.0 °C(Predicted) |
| Density | 1.57±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 9.61±0.20(Predicted) |
| color | White to Light Grey |
| Major Application | general analytical life science and biopharma metabolomics |
| InChI | InChI=1S/C6H7N5/c1-7-5-4-6(10-2-8-4)11-3-9-5/h2-3H,1H3,(H2,7,8,9,10,11) |
| InChIKey | CKOMXBHMKXXTNW-UHFFFAOYSA-N |
| SMILES | N1=CN=C(NC)C=2NC=NC12 |
| CAS DataBase Reference | 443-72-1 |
Safety Information
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 2933998090 |