6-Methyl-1-indanone
- Product Name6-Methyl-1-indanone
- CAS24623-20-9
- MFC10H10O
- MW146.19
- EINECS
- MOL File24623-20-9.mol
Chemical Properties
| Melting point | 60-62 °C (lit.) |
| Boiling point | 70 °C/0.4 mmHg (lit.) |
| Density | 0.9071 (rough estimate) |
| refractive index | 1.5580 (estimate) |
| Flash point | 124-126°C/11mm |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Yellow to Orange |
| BRN | 1448005 |
| InChI | InChI=1S/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | DBOXRDYLMJMQBB-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC(C)=C2)CC1 |
| CAS DataBase Reference | 24623-20-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |
