2-Fluoro-1-methylpyridinium p-toluenesulfonate
- Product Name2-Fluoro-1-methylpyridinium p-toluenesulfonate
- CAS58086-67-2
- MFC13H14FNO3S
- MW283.32
- EINECS261-108-3
- MOL File58086-67-2.mol
Chemical Properties
| Melting point | 130-134 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Acetonitrile (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water (hydrolyzes), DMSO, dichloromethane, and acetonitrile. |
| Sensitive | Moisture Sensitive |
| BRN | 4345357 |
| Stability | Moisture sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H8O3S.C6H7FN/c1-6-2-4-7(5-3-6)11(8,9)10;1-8-5-3-2-4-6(8)7/h2-5H,1H3,(H,8,9,10);2-5H,1H3/q;+1/p-1 |
| InChIKey | HQWDKLAIDBOLFE-UHFFFAOYSA-M |
| SMILES | C1(S(=O)([O-])=O)C=CC(C)=CC=1.C1(F)C=CC=C[N+]=1C |
| CAS DataBase Reference | 58086-67-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
