| Melting point |
<-78°C |
| Boiling point |
120 °C |
| Density |
0.87 |
| vapor pressure |
0.75 hPa ( 25 °C) |
| refractive index |
1.4235-1.4255 |
| Flash point |
76°C |
| storage temp. |
Store below +30°C. |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Specific Gravity |
0.87 |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| Sensitive |
Moisture Sensitive |
| BRN |
2636371 |
| InChI |
1S/C10H24O2Si/c1-9(2)7-13(11-5,12-6)8-10(3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey |
NHYFIJRXGOQNFS-UHFFFAOYSA-N |
| SMILES |
[Si](OC)(OC)(CC(C)C)CC(C)C |
| CAS DataBase Reference |
17980-32-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Silane, dimethoxybis(2-methylpropyl)- (17980-32-4) |
