Silane, methoxydimethylphenyl-
- Product NameSilane, methoxydimethylphenyl-
- CAS17881-88-8
- MFC9H14OSi
- MW166.29
- EINECS
- MOL File17881-88-8.mol
Chemical Properties
| Boiling point | 82°C/28mm |
| refractive index | 1.4850 to 1.4890 |
| Flash point | 82°C/28mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C9H14OSi/c1-10-11(2,3)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | REQXNMOSXYEQLM-UHFFFAOYSA-N |
| SMILES | C1([Si](OC)(C)C)=CC=CC=C1 |
| CAS DataBase Reference | 17881-88-8 |
Safety Information
| Risk Statements | 36/38 |
| Safety Statements | 26-37 |
| RIDADR | UN 1993 3/PG III |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
