Morphine N-oxide
- Product NameMorphine N-oxide
- CAS639-46-3
- MFC17H19NO4
- MW301.34
- EINECS211-355-8
- MOL File639-46-3.mol
Chemical Properties
| Melting point | 222-225°C (dec.) |
| Boiling point | 442.47°C (rough estimate) |
| Density | 1.1222 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| Flash point | 9℃ |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | Aqueous Base (Slightly), Ethanol (Very Slightly, Sonicated) |
| pka | pKa 4.82(50% aq EtOH) (Uncertain) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Major Application | forensics and toxicology |
| InChI | 1S/C17H19NO4/c1-18(21)7-6-17-10-3-5-13(20)16(17)22-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-,18-/m0/s1 |
| InChIKey | AMAPEXTUMXQULJ-CCWAZTPESA-N |
| SMILES | C[N@+]1([O-])CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@@H]2C=C[C@@H]4O)c35 |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| HS Code | 2939190000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| DEA Controlled Substances | CSCN: 9307 CSA SCH: Schedule I NARC: Yes |