9,9-Dimethyl-9H-xanthene
- Product Name9,9-Dimethyl-9H-xanthene
- CAS19814-75-6
- MFC15H14O
- MW210.27
- EINECS1592732-453-0
- MOL File19814-75-6.mol
Chemical Properties
| Melting point | 35 °C |
| Boiling point | 115 °C/0.6 mmHg |
| Density | 1.0232 (rough estimate) |
| refractive index | 1.60 |
| Flash point | 113 °C - closed cup |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystaline |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C15H14O/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10H,1-2H3 |
| InChIKey | MTVNAPYHLASOSX-UHFFFAOYSA-N |
| SMILES | C1(C)(C)C2=C(C=CC=C2)OC2=C1C=CC=C2 |
| CAS DataBase Reference | 19814-75-6 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37-24/25 |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Storage Class | 11 - Combustible Solids |
