1,3-Dimethyluric acid
- Product Name1,3-Dimethyluric acid
- CAS944-73-0
- MFC7H8N4O3
- MW196.16
- EINECS213-410-1
- MOL File944-73-0.mol
Chemical Properties
| Melting point | ≥300 °C(lit.) |
| Boiling point | 333.04°C (rough estimate) |
| Density | 1.4375 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | 1 M NH4OH: soluble50mg/mL, clear to slightly hazy, colorless to faintly yellow |
| pka | 5.61±0.50(Predicted) |
| form | Solid |
| color | Light Yellow |
| InChI | InChI=1S/C7H8N4O3/c1-10-4-3(8-6(13)9-4)5(12)11(2)7(10)14/h1-2H3,(H2,8,9,13) |
| InChIKey | OTSBKHHWSQYEHK-UHFFFAOYSA-N |
| SMILES | N1C2=C(N(C)C(=O)N(C)C2=O)NC1=O |
| CAS DataBase Reference | 944-73-0 |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | UP0783700 |
| HS Code | 29339900 |
| Storage Class | 13 - Non Combustible Solids |
