4,4'-Diaminobenzophenone
- Product Name4,4'-Diaminobenzophenone
- CAS611-98-3
- MFC13H12N2O
- MW212.25
- EINECS251-228-4
- MOL File611-98-3.mol
Chemical Properties
| Melting point | 243-247 °C(lit.) |
| Boiling point | 452.8±30.0 °C(Predicted) |
| Density | 1.233±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 2.81±0.10(Predicted) |
| color | Light yellow to Brown |
| BRN | 2211861 |
| InChI | InChI=1S/C13H12N2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H,14-15H2 |
| InChIKey | ZLSMCQSGRWNEGX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C=C1)(C1=CC=C(N)C=C1)=O |
| CAS DataBase Reference | 611-98-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(4-aminophenyl)methanone(611-98-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
