THIENO[2,3-B]THIOPHENE
- Product NameTHIENO[2,3-B]THIOPHENE
- CAS250-84-0
- MFC6H4S2
- MW140.23
- EINECS
- MOL File250-84-0.mol
Chemical Properties
| Melting point | 7°C(lit.) |
| Boiling point | 226°C(lit.) |
| Density | 1.326 g/cm 3 at 25 °C |
| refractive index | n20/D1.668 |
| Flash point | 93℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H4S2/c1-3-7-6-5(1)2-4-8-6/h1-4H |
| InChIKey | YHBTXTFFTYXOFV-UHFFFAOYSA-N |
| SMILES | C12SC=CC=1C=CS2 |
| LogP | 3.043 (est) |
| CAS DataBase Reference | 250-84-0 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| HS Code | 2934.99.4400 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |