| Melting point |
132-134 °C(lit.) |
| Boiling point |
276.7±35.0 °C(Predicted) |
| Density |
1.4219 (rough estimate) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
RT, stored under nitrogen |
| pka |
6.51±0.27(Predicted) |
| form |
powder to crystal |
| color |
Light yellow to Amber to Dark green |
| Henry's Law Constant |
3.6×10-1 mol/(m3Pa) at 25℃, Schwarzenbach et al. (1988) |
| InChI |
1S/C7H6ClNO3/c1-4-2-7(10)6(9(11)12)3-5(4)8/h2-3,10H,1H3 |
| InChIKey |
JBMGJOKJUYGIJH-UHFFFAOYSA-N |
| SMILES |
Cc1cc(O)c(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference |
7147-89-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenol, 4-chloro-5-methyl-2-nitro- (7147-89-9) |
