Ticlopidine hydrochloride
- Product NameTiclopidine hydrochloride
- CAS53885-35-1
- MFC14H14ClNS.ClH
- MW300.25
- EINECS258-837-4
- MOL File53885-35-1.mol
Chemical Properties
| Melting point | 205°C |
| Density | 1.37 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Sparingly soluble in water and in anhydrous ethanol, very slightly soluble in ethyl acetate. |
| form | Solid |
| pka | 7.64(at 25℃) |
| color | White |
| Water Solubility | Soluble to 100 mM in water and to 100 mM in DMSO. |
| λmax | 295nm(H2O)(lit.) |
| Merck | 14,9421 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | InChI=1S/C14H14ClNS.ClH/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14;/h1-4,6,8H,5,7,9-10H2;1H |
| InChIKey | MTKNGOHFNXIVOS-UHFFFAOYSA-N |
| SMILES | C12C=CSC=1CCN(CC1C=CC=CC=1Cl)C2.Cl |
| CAS DataBase Reference | 53885-35-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-37/39-26 |
| WGK Germany | 3 |
| RTECS | XJ9089100 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in mice (mg/kg/24 hrs): 55 i.v.; >300 orally (Castaigne) |