(-)-PERILLIC ACID
- Product Name(-)-PERILLIC ACID
- CAS23635-14-5
- MFC10H14O2
- MW166.22
- EINECS
- MOL File23635-14-5.mol
Chemical Properties
| Melting point | 129-131 °C(lit.) |
| Boiling point | 284.9±40.0 °C(Predicted) |
| Density | 1.068±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.94±0.40(Predicted) |
| form | White to off-white solid. |
| color | White to off-white |
| optical activity | [α]20/D 102°, c = 2 in methanol |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | 1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | CDSMSBUVCWHORP-MRVPVSSYSA-N |
| SMILES | CC(=C)[C@H]1CCC(=CC1)C(O)=O |
| LogP | 2.960 (est) |
| CAS DataBase Reference | 23635-14-5 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29162000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
