2,5-Dibromo-6-methylpyridine
- Product Name2,5-Dibromo-6-methylpyridine
- CAS39919-65-8
- MFC6H5Br2N
- MW250.92
- EINECS
- MOL File39919-65-8.mol
Chemical Properties
| Melting point | 0°C |
| Boiling point | 0°C |
| Density | 1.911±0.06 g/cm3(Predicted) |
| Flash point | 0°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -0.84±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H5Br2N/c1-4-5(7)2-3-6(8)9-4/h2-3H,1H3 |
| InChIKey | UCHKRHGVKYVGTC-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(Br)=CC=C1Br |
| CAS DataBase Reference | 39919-65-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |