BETA-AMANITIN
- Product NameBETA-AMANITIN
- CAS21150-22-1
- MFC39H53N9O15S
- MW919.96
- EINECS244-244-8
- MOL File21150-22-1.mol
Chemical Properties
| Melting point | 300° |
| Boiling point | 1599.6±65.0 °C(Predicted) |
| Density | 1.1725 (rough estimate) |
| refractive index | 1.7400 (estimate) |
| storage temp. | −20°C |
| solubility | Water: 1 mg/ml |
| form | White to off-white powder. |
| pka | 4.02±0.10(Predicted) |
| color | White to off-white |
| Sequence | Ile-{6-hydroxy-Trp}-Gly-Ile-Gly-Cys-Asn-Pro (Sulfidebridge try4-cys8) |
| InChIKey | IEQCUEXVAPAFMQ-UHFFFAOYSA-N |
| SMILES | CCC(C)C1NC(=O)CNC(=O)C2Cc3c([nH]c4cc(O)ccc34)S(=O)CC(NC(=O)CNC1=O)C(=O)NC(CC(O)=O)C(=O)N5CC(O)CC5C(=O)NC(C(C)C(O)CO)C(=O)N2 |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 7-28-36/37/39-45 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | NJ8324000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 2934999090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
| Toxicity | LD50 i.p. in albino mice: 0.4 mg/kg (Wieland, Wieland) |
