2,6-Dichloroindophenol sodium salt hydrate
- Product Name2,6-Dichloroindophenol sodium salt hydrate
- CAS1266615-56-8
- MFC12H10Cl2NNaO3
- MW310.11
- EINECS210-640-4
- MOL FileMol File
Chemical Properties
| Melting point | 277 °C (dec.)(lit.) |
| storage temp. | room temp |
| solubility | H2O: soluble10mg/mL, clear, blue to very deep blue |
| form | Powder |
| color | Red to brown |
| Water Solubility | H2O: soluble 10mg/mL, clear, blue to very deep blue |
| λmax | 605 nm |
| BRN | 3641229 |
| Major Application | diagnostic assay manufacturing food and beverages hematology histology |
| InChI | 1S/C12H7Cl2NO2.Na.H2O/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7;;/h1-6,16H;;1H2/q;+1;/p-1 |
| InChIKey | XHSOLXWCGCVQHE-UHFFFAOYSA-M |
| SMILES | O.[Na+].[O-]c1ccc(cc1)\N=C2/C=C(Cl)C(=O)C(Cl)=C2 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GU5495000 |
| F | 8 |
| Storage Class | 11 - Combustible Solids |