Perfluorononanoic acid
- Product NamePerfluorononanoic acid
- CAS375-95-1
- MFC9HF17O2
- MW464.08
- EINECS206-801-3
- MOL File375-95-1.mol
Chemical Properties
| Melting point | 59-62 °C (lit.) |
| Boiling point | 218°C |
| Density | 1.7397 (estimate) |
| Flash point | 218°C |
| storage temp. | Refrigerator |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 0.52±0.10(Predicted) |
| form | Solid |
| color | Off-White to Beige |
| BRN | 1897287 |
| Henry's Law Constant | 4.3×10-2 mol/(m3Pa) at 25℃, Arp et al. (2006) |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. Corrosive - causes burns. |
| InChI | InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28) |
| InChIKey | UZUFPBIDKMEQEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 375-95-1(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorononanoic acid (375-95-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 |
| Hazardous Substances Data | 375-95-1(Hazardous Substances Data) |
